C23H27F10N4O- — CID 162238818
[(2R)-3-[3,4-bis(1,1,2,2,2-pentafluoroethyl)phenyl]-1-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-1-oxopropan-2-yl]azanide (PubChem CID 162238818) has the molecular formula C23H27F10N4O- and a molecular weight of 565.48 g/mol. Its IUPAC name is [(2R)-3-[3,4-bis(1,1,2,2,2-pentafluoroethyl)phenyl]-1-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-1-oxopropan-2-yl]azanide.
| Compound Name | [(2R)-3-[3,4-bis(1,1,2,2,2-pentafluoroethyl)phenyl]-1-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-1-oxopropan-2-yl]azanide |
|---|---|
| PubChem CID | 162238818 |
| Molecular Formula | C23H27F10N4O- |
| Molecular Weight | 565.48 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | [(2R)-3-[3,4-bis(1,1,2,2,2-pentafluoroethyl)phenyl]-1-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-1-oxopropan-2-yl]azanide |
| SMILES | CN1CCN(C2CCN(C(=O)[C@H]([NH-])Cc3ccc(C(F)(F)C(F)(F)F)c(C(F)(F)C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C23H27F10N4O/c1-35-8-10-36(11-9-35)15-4-6-37(7-5-15)19(38)18(34)13-14-2-3-16(20(24,25)22(28,29)30)17(12-14)21(26,27)23(31,32)33/h2-3,12,15,18,34H,4-11,13H2,1H3/q-1/t18-/m1/s1 |
| InChIKey | ZWKUJVVBOCXZLN-GOSISDBHSA-N |
| XLogP | 5.20 |
| TPSA | 50.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|