C23H26F10N4O2 — CID 173094891
4-[1-[3-[3,4-bis(1,1,2,2,2-pentafluoroethyl)phenyl]propanoyl]piperidin-4-yl]piperazine-1-carboxamide (PubChem CID 173094891) has the molecular formula C23H26F10N4O2 and a molecular weight of 580.47 g/mol. Its IUPAC name is 4-[1-[3-[3,4-bis(1,1,2,2,2-pentafluoroethyl)phenyl]propanoyl]piperidin-4-yl]piperazine-1-carboxamide.
| Compound Name | 4-[1-[3-[3,4-bis(1,1,2,2,2-pentafluoroethyl)phenyl]propanoyl]piperidin-4-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 173094891 |
| Molecular Formula | C23H26F10N4O2 |
| Molecular Weight | 580.47 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | 4-[1-[3-[3,4-bis(1,1,2,2,2-pentafluoroethyl)phenyl]propanoyl]piperidin-4-yl]piperazine-1-carboxamide |
| SMILES | NC(=O)N1CCN(C2CCN(C(=O)CCc3ccc(C(F)(F)C(F)(F)F)c(C(F)(F)C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C23H26F10N4O2/c24-20(25,22(28,29)30)16-3-1-14(13-17(16)21(26,27)23(31,32)33)2-4-18(38)36-7-5-15(6-8-36)35-9-11-37(12-10-35)19(34)39/h1,3,13,15H,2,4-12H2,(H2,34,39) |
| InChIKey | LCONFABTNWYERU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|