C30H40N2O3 — CID 162241989
N-[(1S,3aS,6aR)-6-[(2S)-3,3-dimethyl-2-[[(2R)-2-methylbutanoyl]amino]butanoyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]naphthalene-1-carboxamide (PubChem CID 162241989) has the molecular formula C30H40N2O3 and a molecular weight of 476.66 g/mol. Its IUPAC name is N-[(1S,3aS,6aR)-6-[(2S)-3,3-dimethyl-2-[[(2R)-2-methylbutanoyl]amino]butanoyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]naphthalene-1-carboxamide.
| Compound Name | N-[(1S,3aS,6aR)-6-[(2S)-3,3-dimethyl-2-[[(2R)-2-methylbutanoyl]amino]butanoyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 162241989 |
| Molecular Formula | C30H40N2O3 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | N-[(1S,3aS,6aR)-6-[(2S)-3,3-dimethyl-2-[[(2R)-2-methylbutanoyl]amino]butanoyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]naphthalene-1-carboxamide |
| SMILES | CC[C@@H](C)C(=O)N[C@H](C(=O)C1CC[C@H]2CC[C@H](NC(=O)c3cccc4ccccc34)[C@@H]12)C(C)(C)C |
| InChI | InChI=1S/C30H40N2O3/c1-6-18(2)28(34)32-27(30(3,4)5)26(33)23-16-14-20-15-17-24(25(20)23)31-29(35)22-13-9-11-19-10-7-8-12-21(19)22/h7-13,18,20,23-25,27H,6,14-17H2,1-5H3,(H,31,35)(H,32,34)/t18-,20+,23?,24+,25-,27-/m1/s1 |
| InChIKey | ZWVCMRBZEGMNRU-MXUOKGAPSA-N |
| XLogP | 5.52 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |