C28H33BrN4O — CID 162243148
5-(4-bromophenyl)-2-tert-butyl-1H-imidazole;4-(2-tert-butyl-1-methylimidazol-4-yl)benzaldehyde (PubChem CID 162243148) has the molecular formula C28H33BrN4O and a molecular weight of 521.50 g/mol. Its IUPAC name is 5-(4-bromophenyl)-2-tert-butyl-1H-imidazole;4-(2-tert-butyl-1-methylimidazol-4-yl)benzaldehyde.
| Compound Name | 5-(4-bromophenyl)-2-tert-butyl-1H-imidazole;4-(2-tert-butyl-1-methylimidazol-4-yl)benzaldehyde |
|---|---|
| PubChem CID | 162243148 |
| Molecular Formula | C28H33BrN4O |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 5-(4-bromophenyl)-2-tert-butyl-1H-imidazole;4-(2-tert-butyl-1-methylimidazol-4-yl)benzaldehyde |
| SMILES | CC(C)(C)c1ncc(-c2ccc(Br)cc2)[nH]1.Cn1cc(-c2ccc(C=O)cc2)nc1C(C)(C)C |
| InChI | InChI=1S/C15H18N2O.C13H15BrN2/c1-15(2,3)14-16-13(9-17(14)4)12-7-5-11(10-18)6-8-12;1-13(2,3)12-15-8-11(16-12)9-4-6-10(14)7-5-9/h5-10H,1-4H3;4-8H,1-3H3,(H,15,16) |
| InChIKey | ZWYZFOJZUXFKNZ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|