C25H34Cl2O6Si — CID 162249500
1-(3-chloro-2,5-dihydroxyphenyl)ethanone;1-[3-chloro-2-hydroxy-5-tri(propan-2-yl)silyloxyphenyl]ethanone (PubChem CID 162249500) has the molecular formula C25H34Cl2O6Si and a molecular weight of 529.53 g/mol. Its IUPAC name is 1-(3-chloro-2,5-dihydroxyphenyl)ethanone;1-[3-chloro-2-hydroxy-5-tri(propan-2-yl)silyloxyphenyl]ethanone.
| Compound Name | 1-(3-chloro-2,5-dihydroxyphenyl)ethanone;1-[3-chloro-2-hydroxy-5-tri(propan-2-yl)silyloxyphenyl]ethanone |
|---|---|
| PubChem CID | 162249500 |
| Molecular Formula | C25H34Cl2O6Si |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | 1-(3-chloro-2,5-dihydroxyphenyl)ethanone;1-[3-chloro-2-hydroxy-5-tri(propan-2-yl)silyloxyphenyl]ethanone |
| SMILES | CC(=O)c1cc(O)cc(Cl)c1O.CC(=O)c1cc(O[Si](C(C)C)(C(C)C)C(C)C)cc(Cl)c1O |
| InChI | InChI=1S/C17H27ClO3Si.C8H7ClO3/c1-10(2)22(11(3)4,12(5)6)21-14-8-15(13(7)19)17(20)16(18)9-14;1-4(10)6-2-5(11)3-7(9)8(6)12/h8-12,20H,1-7H3;2-3,11-12H,1H3 |
| InChIKey | ZXUIZGCNGYWSFV-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|