C25H27N5O5 — CID 162251730
6-[(4R)-4-[5-(6-methoxy-3-oxopyrido[2,3-b]pyrazin-4-yl)pentyl]-2-oxopyrrolidin-1-yl]-4H-pyrano[3,2-b]pyridin-3-one (PubChem CID 162251730) has the molecular formula C25H27N5O5 and a molecular weight of 477.52 g/mol. Its IUPAC name is 6-[(4R)-4-[5-(6-methoxy-3-oxopyrido[2,3-b]pyrazin-4-yl)pentyl]-2-oxopyrrolidin-1-yl]-4H-pyrano[3,2-b]pyridin-3-one.
| Compound Name | 6-[(4R)-4-[5-(6-methoxy-3-oxopyrido[2,3-b]pyrazin-4-yl)pentyl]-2-oxopyrrolidin-1-yl]-4H-pyrano[3,2-b]pyridin-3-one |
|---|---|
| PubChem CID | 162251730 |
| Molecular Formula | C25H27N5O5 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 6-[(4R)-4-[5-(6-methoxy-3-oxopyrido[2,3-b]pyrazin-4-yl)pentyl]-2-oxopyrrolidin-1-yl]-4H-pyrano[3,2-b]pyridin-3-one |
| SMILES | COc1ccc2ncc(=O)n(CCCCC[C@@H]3CC(=O)N(c4ccc5c(n4)CC(=O)CO5)C3)c2n1 |
| InChI | InChI=1S/C25H27N5O5/c1-34-22-9-6-18-25(28-22)29(24(33)13-26-18)10-4-2-3-5-16-11-23(32)30(14-16)21-8-7-20-19(27-21)12-17(31)15-35-20/h6-9,13,16H,2-5,10-12,14-15H2,1H3/t16-/m1/s1 |
| InChIKey | IEFYTCFUWGSNKX-MRXNPFEDSA-N |
| XLogP | 2.31 |
| TPSA | 116.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|