C5H12Cl4O7P2 — CID 162253126
CID 162253126 (PubChem CID 162253126) has the molecular formula C5H12Cl4O7P2 and a molecular weight of 387.90 g/mol.
| Compound Name | CID 162253126 |
|---|---|
| PubChem CID | 162253126 |
| Molecular Formula | C5H12Cl4O7P2 |
| Molecular Weight | 387.90 g/mol |
| Exact Mass | 385.88 |
| IUPAC Name | — |
| SMILES | O=P(Cl)(Cl)OP(=O)(Cl)Cl.OCC(CO)(CO)CO |
| InChI | InChI=1S/C5H12O4.Cl4O3P2/c6-1-5(2-7,3-8)4-9;1-8(2,5)7-9(3,4)6/h6-9H,1-4H2; |
| InChIKey | ZYGALACOHWWQGU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.90 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|