C10H16F3NO2 — CID 162253403
propan-2-yl 3-methyl-2-(2,2,2-trifluoroethylimino)butanoate (PubChem CID 162253403) has the molecular formula C10H16F3NO2 and a molecular weight of 239.24 g/mol. Its IUPAC name is propan-2-yl 3-methyl-2-(2,2,2-trifluoroethylimino)butanoate.
| Compound Name | propan-2-yl 3-methyl-2-(2,2,2-trifluoroethylimino)butanoate |
|---|---|
| PubChem CID | 162253403 |
| Molecular Formula | C10H16F3NO2 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | propan-2-yl 3-methyl-2-(2,2,2-trifluoroethylimino)butanoate |
| SMILES | CC(C)OC(=O)/C(=N/CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C10H16F3NO2/c1-6(2)8(9(15)16-7(3)4)14-5-10(11,12)13/h6-7H,5H2,1-4H3/b14-8+ |
| InChIKey | KIRZYLNLQDUZIM-RIYZIHGNSA-N |
| XLogP | 2.60 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|