C20H21Cl2F4NO2 — CID 162253748
1,3-dichloro-2-(2,3-difluorophenyl)propan-2-ol;3-(2,3-difluorophenyl)-1-ethylazetidin-3-ol (PubChem CID 162253748) has the molecular formula C20H21Cl2F4NO2 and a molecular weight of 454.29 g/mol. Its IUPAC name is 1,3-dichloro-2-(2,3-difluorophenyl)propan-2-ol;3-(2,3-difluorophenyl)-1-ethylazetidin-3-ol.
| Compound Name | 1,3-dichloro-2-(2,3-difluorophenyl)propan-2-ol;3-(2,3-difluorophenyl)-1-ethylazetidin-3-ol |
|---|---|
| PubChem CID | 162253748 |
| Molecular Formula | C20H21Cl2F4NO2 |
| Molecular Weight | 454.29 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 1,3-dichloro-2-(2,3-difluorophenyl)propan-2-ol;3-(2,3-difluorophenyl)-1-ethylazetidin-3-ol |
| SMILES | CCN1CC(O)(c2cccc(F)c2F)C1.OC(CCl)(CCl)c1cccc(F)c1F |
| InChI | InChI=1S/C11H13F2NO.C9H8Cl2F2O/c1-2-14-6-11(15,7-14)8-4-3-5-9(12)10(8)13;10-4-9(14,5-11)6-2-1-3-7(12)8(6)13/h3-5,15H,2,6-7H2,1H3;1-3,14H,4-5H2 |
| InChIKey | ZYICGBOKBMFEIS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.29 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|