C19H20F2N2O2 — CID 162254628
1-cyclopropyl-5,6-difluoro-8-methyl-7-[(3S)-3-methylpyrrolidin-1-yl]-2-oxoquinoline-4-carbaldehyde (PubChem CID 162254628) has the molecular formula C19H20F2N2O2 and a molecular weight of 346.38 g/mol. Its IUPAC name is 1-cyclopropyl-5,6-difluoro-8-methyl-7-[(3S)-3-methylpyrrolidin-1-yl]-2-oxoquinoline-4-carbaldehyde.
| Compound Name | 1-cyclopropyl-5,6-difluoro-8-methyl-7-[(3S)-3-methylpyrrolidin-1-yl]-2-oxoquinoline-4-carbaldehyde |
|---|---|
| PubChem CID | 162254628 |
| Molecular Formula | C19H20F2N2O2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-cyclopropyl-5,6-difluoro-8-methyl-7-[(3S)-3-methylpyrrolidin-1-yl]-2-oxoquinoline-4-carbaldehyde |
| SMILES | Cc1c(N2CC[C@H](C)C2)c(F)c(F)c2c(C=O)cc(=O)n(C3CC3)c12 |
| InChI | InChI=1S/C19H20F2N2O2/c1-10-5-6-22(8-10)19-11(2)18-15(16(20)17(19)21)12(9-24)7-14(25)23(18)13-3-4-13/h7,9-10,13H,3-6,8H2,1-2H3/t10-/m0/s1 |
| InChIKey | CJCMLKBFWCINBN-JTQLQIEISA-N |
| XLogP | 3.58 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|