C22H46N4O — CID 162256772
1-tert-butyl-4-(2-methoxyethyl)piperazine;1-(1-tert-butylpiperidin-3-yl)ethenamine (PubChem CID 162256772) has the molecular formula C22H46N4O and a molecular weight of 382.64 g/mol. Its IUPAC name is 1-tert-butyl-4-(2-methoxyethyl)piperazine;1-(1-tert-butylpiperidin-3-yl)ethenamine.
| Compound Name | 1-tert-butyl-4-(2-methoxyethyl)piperazine;1-(1-tert-butylpiperidin-3-yl)ethenamine |
|---|---|
| PubChem CID | 162256772 |
| Molecular Formula | C22H46N4O |
| Molecular Weight | 382.64 g/mol |
| Exact Mass | 382.37 |
| IUPAC Name | 1-tert-butyl-4-(2-methoxyethyl)piperazine;1-(1-tert-butylpiperidin-3-yl)ethenamine |
| SMILES | C=C(N)C1CCCN(C(C)(C)C)C1.COCCN1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C11H24N2O.C11H22N2/c1-11(2,3)13-7-5-12(6-8-13)9-10-14-4;1-9(12)10-6-5-7-13(8-10)11(2,3)4/h5-10H2,1-4H3;10H,1,5-8,12H2,2-4H3 |
| InChIKey | ZYRUMYOKHUTVMU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 44.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |