C34H27N3O5S — CID 162258633
[5-[3-(3,4-dimethoxy-5-methylphenyl)phenanthro[9,10-d]imidazol-2-yl]quinolin-4-yl] methanesulfonate (PubChem CID 162258633) has the molecular formula C34H27N3O5S and a molecular weight of 589.67 g/mol. Its IUPAC name is [5-[3-(3,4-dimethoxy-5-methylphenyl)phenanthro[9,10-d]imidazol-2-yl]quinolin-4-yl] methanesulfonate.
| Compound Name | [5-[3-(3,4-dimethoxy-5-methylphenyl)phenanthro[9,10-d]imidazol-2-yl]quinolin-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 162258633 |
| Molecular Formula | C34H27N3O5S |
| Molecular Weight | 589.67 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | [5-[3-(3,4-dimethoxy-5-methylphenyl)phenanthro[9,10-d]imidazol-2-yl]quinolin-4-yl] methanesulfonate |
| SMILES | COc1cc(-n2c(-c3cccc4nccc(OS(C)(=O)=O)c34)nc3c4ccccc4c4ccccc4c32)cc(C)c1OC |
| InChI | InChI=1S/C34H27N3O5S/c1-20-18-21(19-29(40-2)33(20)41-3)37-32-25-13-8-6-11-23(25)22-10-5-7-12-24(22)31(32)36-34(37)26-14-9-15-27-30(26)28(16-17-35-27)42-43(4,38)39/h5-19H,1-4H3 |
| InChIKey | AYXCDMPPLLTODO-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.67 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|