C23H25Cl2N3O5 — CID 162261787
2-aminoacetic acid;1-[(4-tert-butylphenyl)methyl]-3-(2,4-dichlorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 162261787) has the molecular formula C23H25Cl2N3O5 and a molecular weight of 494.38 g/mol. Its IUPAC name is 2-aminoacetic acid;1-[(4-tert-butylphenyl)methyl]-3-(2,4-dichlorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 2-aminoacetic acid;1-[(4-tert-butylphenyl)methyl]-3-(2,4-dichlorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 162261787 |
| Molecular Formula | C23H25Cl2N3O5 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 2-aminoacetic acid;1-[(4-tert-butylphenyl)methyl]-3-(2,4-dichlorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)(C)c1ccc(CN2C(=O)CC(=O)N(c3ccc(Cl)cc3Cl)C2=O)cc1.NCC(=O)O |
| InChI | InChI=1S/C21H20Cl2N2O3.C2H5NO2/c1-21(2,3)14-6-4-13(5-7-14)12-24-18(26)11-19(27)25(20(24)28)17-9-8-15(22)10-16(17)23;3-1-2(4)5/h4-10H,11-12H2,1-3H3;1,3H2,(H,4,5) |
| InChIKey | ZZISGUGRILQJFL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|