C7H7I2NO — CID 162265353
N,2-diiodo-4-methoxyaniline (PubChem CID 162265353) has the molecular formula C7H7I2NO and a molecular weight of 374.95 g/mol. Its IUPAC name is N,2-diiodo-4-methoxyaniline.
| Compound Name | N,2-diiodo-4-methoxyaniline |
|---|---|
| PubChem CID | 162265353 |
| Molecular Formula | C7H7I2NO |
| Molecular Weight | 374.95 g/mol |
| Exact Mass | 374.86 |
| IUPAC Name | N,2-diiodo-4-methoxyaniline |
| SMILES | COc1ccc(NI)c(I)c1 |
| InChI | InChI=1S/C7H7I2NO/c1-11-5-2-3-7(10-9)6(8)4-5/h2-4,10H,1H3 |
| InChIKey | ZZVHHBBTNQUUOW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.95 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|