C31H47NSi — CID 162267961
N-tert-butyl-N-[dimethyl-(2,9,9-trimethyl-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-1-yl)silyl]cyclohexanamine (PubChem CID 162267961) has the molecular formula C31H47NSi and a molecular weight of 461.81 g/mol. Its IUPAC name is N-tert-butyl-N-[dimethyl-(2,9,9-trimethyl-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-1-yl)silyl]cyclohexanamine.
| Compound Name | N-tert-butyl-N-[dimethyl-(2,9,9-trimethyl-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-1-yl)silyl]cyclohexanamine |
|---|---|
| PubChem CID | 162267961 |
| Molecular Formula | C31H47NSi |
| Molecular Weight | 461.81 g/mol |
| Exact Mass | 461.35 |
| IUPAC Name | N-tert-butyl-N-[dimethyl-(2,9,9-trimethyl-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-1-yl)silyl]cyclohexanamine |
| SMILES | CC1CC2C=C3C(=CC2C1[Si](C)(C)N(C1CCCCC1)C(C)(C)C)C(C)(C)c1ccccc13 |
| InChI | InChI=1S/C31H47NSi/c1-21-18-22-19-26-24-16-12-13-17-27(24)31(5,6)28(26)20-25(22)29(21)33(7,8)32(30(2,3)4)23-14-10-9-11-15-23/h12-13,16-17,19-23,25,29H,9-11,14-15,18H2,1-8H3 |
| InChIKey | BADIWJKWRNSEML-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.81 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|