C41H59NSi — CID 162279059
N-tert-butyl-N-[[7-(4-tert-butylphenyl)-2,9,9-trimethyl-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-1-yl]-dimethylsilyl]cyclohexanamine (PubChem CID 162279059) has the molecular formula C41H59NSi and a molecular weight of 594.02 g/mol. Its IUPAC name is N-tert-butyl-N-[[7-(4-tert-butylphenyl)-2,9,9-trimethyl-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-1-yl]-dimethylsilyl]cyclohexanamine.
| Compound Name | N-tert-butyl-N-[[7-(4-tert-butylphenyl)-2,9,9-trimethyl-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-1-yl]-dimethylsilyl]cyclohexanamine |
|---|---|
| PubChem CID | 162279059 |
| Molecular Formula | C41H59NSi |
| Molecular Weight | 594.02 g/mol |
| Exact Mass | 593.44 |
| IUPAC Name | N-tert-butyl-N-[[7-(4-tert-butylphenyl)-2,9,9-trimethyl-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-1-yl]-dimethylsilyl]cyclohexanamine |
| SMILES | CC1CC2C=C3C(=CC2C1[Si](C)(C)N(C1CCCCC1)C(C)(C)C)C(C)(C)c1cc(-c2ccc(C(C)(C)C)cc2)ccc13 |
| InChI | InChI=1S/C41H59NSi/c1-27-23-30-24-35-33-22-19-29(28-17-20-31(21-18-28)39(2,3)4)25-36(33)41(8,9)37(35)26-34(30)38(27)43(10,11)42(40(5,6)7)32-15-13-12-14-16-32/h17-22,24-27,30,32,34,38H,12-16,23H2,1-11H3 |
| InChIKey | QGWHBHXAIMBTAO-UHFFFAOYSA-N |
| XLogP | 11.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.02 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|