C18H28N+ — CID 162270187
5-butyl-2-[(3-ethyl-2-methylcyclopenta-2,4-dien-1-yl)methyl]-1-methyl-3H-pyrrol-1-ium (PubChem CID 162270187) has the molecular formula C18H28N+ and a molecular weight of 258.43 g/mol. Its IUPAC name is 5-butyl-2-[(3-ethyl-2-methylcyclopenta-2,4-dien-1-yl)methyl]-1-methyl-3H-pyrrol-1-ium.
| Compound Name | 5-butyl-2-[(3-ethyl-2-methylcyclopenta-2,4-dien-1-yl)methyl]-1-methyl-3H-pyrrol-1-ium |
|---|---|
| PubChem CID | 162270187 |
| Molecular Formula | C18H28N+ |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | 5-butyl-2-[(3-ethyl-2-methylcyclopenta-2,4-dien-1-yl)methyl]-1-methyl-3H-pyrrol-1-ium |
| SMILES | CCCCC1=CCC(CC2C=CC(CC)=C2C)=[N+]1C |
| InChI | InChI=1S/C18H28N/c1-5-7-8-17-11-12-18(19(17)4)13-16-10-9-15(6-2)14(16)3/h9-11,16H,5-8,12-13H2,1-4H3/q+1 |
| InChIKey | ZIMSHPQOZZREHR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|