C25H37N — CID 126661368
(E)-5-cyclopenta-1,3-dien-1-yl-N-[(2Z,7Z)-5-ethenyl-4,6-dimethylnona-2,7-dien-3-yl]hept-5-en-2-imine (PubChem CID 126661368) has the molecular formula C25H37N and a molecular weight of 351.58 g/mol. Its IUPAC name is (E)-5-cyclopenta-1,3-dien-1-yl-N-[(2Z,7Z)-5-ethenyl-4,6-dimethylnona-2,7-dien-3-yl]hept-5-en-2-imine.
| Compound Name | (E)-5-cyclopenta-1,3-dien-1-yl-N-[(2Z,7Z)-5-ethenyl-4,6-dimethylnona-2,7-dien-3-yl]hept-5-en-2-imine |
|---|---|
| PubChem CID | 126661368 |
| Molecular Formula | C25H37N |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | (E)-5-cyclopenta-1,3-dien-1-yl-N-[(2Z,7Z)-5-ethenyl-4,6-dimethylnona-2,7-dien-3-yl]hept-5-en-2-imine |
| SMILES | C=CC(C(C)/C=C\C)C(C)C(=C/C)/N=C(\C)CC/C(=C\C)C1=CC=CC1 |
| InChI | InChI=1S/C25H37N/c1-8-14-19(5)24(10-3)21(7)25(11-4)26-20(6)17-18-22(9-2)23-15-12-13-16-23/h8-15,19,21,24H,3,16-18H2,1-2,4-7H3/b14-8-,22-9+,25-11-,26-20+ |
| InChIKey | QKDCGMLIPGVIGK-DYXVTIKZSA-N |
| XLogP | 7.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|