C19H31N — CID 123388806
4-cyclopentyl-3-methyl-N-[(2E)-3-methylocta-2,4,7-trien-4-yl]butan-2-imine (PubChem CID 123388806) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is 4-cyclopentyl-3-methyl-N-[(2E)-3-methylocta-2,4,7-trien-4-yl]butan-2-imine.
| Compound Name | 4-cyclopentyl-3-methyl-N-[(2E)-3-methylocta-2,4,7-trien-4-yl]butan-2-imine |
|---|---|
| PubChem CID | 123388806 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 4-cyclopentyl-3-methyl-N-[(2E)-3-methylocta-2,4,7-trien-4-yl]butan-2-imine |
| SMILES | C=CCC=C(/N=C(\C)C(C)CC1CCCC1)/C(C)=C/C |
| InChI | InChI=1S/C19H31N/c1-6-8-13-19(15(3)7-2)20-17(5)16(4)14-18-11-9-10-12-18/h6-7,13,16,18H,1,8-12,14H2,2-5H3/b15-7+,19-13?,20-17+ |
| InChIKey | HNJBRSOTRVJMQW-LRTOSUHWSA-N |
| XLogP | 6.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|