C18H31N — CID 123167041
N-[(3E,5Z)-4,5-dimethylnona-3,5,8-trien-3-yl]-4-methylhexan-2-imine (PubChem CID 123167041) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is N-[(3E,5Z)-4,5-dimethylnona-3,5,8-trien-3-yl]-4-methylhexan-2-imine.
| Compound Name | N-[(3E,5Z)-4,5-dimethylnona-3,5,8-trien-3-yl]-4-methylhexan-2-imine |
|---|---|
| PubChem CID | 123167041 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | N-[(3E,5Z)-4,5-dimethylnona-3,5,8-trien-3-yl]-4-methylhexan-2-imine |
| SMILES | C=CC/C=C(C)\C(C)=C(CC)\N=C(/C)CC(C)CC |
| InChI | InChI=1S/C18H31N/c1-8-11-12-15(5)17(7)18(10-3)19-16(6)13-14(4)9-2/h8,12,14H,1,9-11,13H2,2-7H3/b15-12-,18-17+,19-16+ |
| InChIKey | BMKQTDYXOPDDML-MYHDGQFMSA-N |
| XLogP | 6.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|