C16H26BN — CID 123356473
CID 123356473 (PubChem CID 123356473) has the molecular formula C16H26BN and a molecular weight of 243.20 g/mol.
| Compound Name | CID 123356473 |
|---|---|
| PubChem CID | 123356473 |
| Molecular Formula | C16H26BN |
| Molecular Weight | 243.20 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | — |
| SMILES | [B]/C(CCCC)=N\C(\C=C/C=CC)=C(\C)C(C)C |
| InChI | InChI=1S/C16H26BN/c1-6-8-10-11-15(14(5)13(3)4)18-16(17)12-9-7-2/h6,8,10-11,13H,7,9,12H2,1-5H3/b8-6?,11-10-,15-14-,18-16- |
| InChIKey | QFHZKJQQVHDAML-FGUJHUFASA-N |
| XLogP | 4.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.20 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|