C15H24BN — CID 123355696
CID 123355696 (PubChem CID 123355696) has the molecular formula C15H24BN and a molecular weight of 229.18 g/mol.
| Compound Name | CID 123355696 |
|---|---|
| PubChem CID | 123355696 |
| Molecular Formula | C15H24BN |
| Molecular Weight | 229.18 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | — |
| SMILES | [B]/C(CCC)=N\C(\C=C/C=CC)=C(\C)C(C)C |
| InChI | InChI=1S/C15H24BN/c1-6-8-9-11-14(13(5)12(3)4)17-15(16)10-7-2/h6,8-9,11-12H,7,10H2,1-5H3/b8-6?,11-9-,14-13-,17-15- |
| InChIKey | XPDNBRDWPAYSOV-MTHUOUTDSA-N |
| XLogP | 4.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.18 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|