C13H23N — CID 129067903
N-[(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-3-methylbutan-2-imine (PubChem CID 129067903) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is N-[(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-3-methylbutan-2-imine.
| Compound Name | N-[(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-3-methylbutan-2-imine |
|---|---|
| PubChem CID | 129067903 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | N-[(3Z)-2,5-dimethylhexa-3,5-dien-3-yl]-3-methylbutan-2-imine |
| SMILES | C=C(C)/C=C(\N=C(/C)C(C)C)C(C)C |
| InChI | InChI=1S/C13H23N/c1-9(2)8-13(11(5)6)14-12(7)10(3)4/h8,10-11H,1H2,2-7H3/b13-8-,14-12+ |
| InChIKey | KIQKMCPUFRVMLI-BEDYTIOTSA-N |
| XLogP | 4.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|