C12H23N — CID 59879256
N-[(Z)-3,4-dimethylpent-2-en-2-yl]-3-methylbutan-2-imine (PubChem CID 59879256) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N-[(Z)-3,4-dimethylpent-2-en-2-yl]-3-methylbutan-2-imine.
| Compound Name | N-[(Z)-3,4-dimethylpent-2-en-2-yl]-3-methylbutan-2-imine |
|---|---|
| PubChem CID | 59879256 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N-[(Z)-3,4-dimethylpent-2-en-2-yl]-3-methylbutan-2-imine |
| SMILES | CC(/N=C(\C)C(C)C)=C(\C)C(C)C |
| InChI | InChI=1S/C12H23N/c1-8(2)10(5)12(7)13-11(6)9(3)4/h8-9H,1-7H3/b12-10-,13-11+ |
| InChIKey | ZIOIQGKWARZFHB-PJABCKPXSA-N |
| XLogP | 4.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|