C18H29N — CID 137466884
3-methyl-N-[(4Z,6Z)-6-prop-2-enylidenedeca-1,4-dien-2-yl]butan-2-imine (PubChem CID 137466884) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is 3-methyl-N-[(4Z,6Z)-6-prop-2-enylidenedeca-1,4-dien-2-yl]butan-2-imine.
| Compound Name | 3-methyl-N-[(4Z,6Z)-6-prop-2-enylidenedeca-1,4-dien-2-yl]butan-2-imine |
|---|---|
| PubChem CID | 137466884 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 3-methyl-N-[(4Z,6Z)-6-prop-2-enylidenedeca-1,4-dien-2-yl]butan-2-imine |
| SMILES | C=C/C=C(\C=C/CC(=C)/N=C(\C)C(C)C)CCCC |
| InChI | InChI=1S/C18H29N/c1-7-9-13-18(11-8-2)14-10-12-16(5)19-17(6)15(3)4/h8,10-11,14-15H,2,5,7,9,12-13H2,1,3-4,6H3/b14-10-,18-11-,19-17+ |
| InChIKey | MNOPRABVWOOWKG-GTWFYMJOSA-N |
| XLogP | 5.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|