C17H28N2 — CID 123731155
N-tert-butyl-5-ethyl-2,6-dimethyl-7-[(Z)-prop-1-enyl]-4,5-dihydroazepin-3-imine (PubChem CID 123731155) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is N-tert-butyl-5-ethyl-2,6-dimethyl-7-[(Z)-prop-1-enyl]-4,5-dihydroazepin-3-imine.
| Compound Name | N-tert-butyl-5-ethyl-2,6-dimethyl-7-[(Z)-prop-1-enyl]-4,5-dihydroazepin-3-imine |
|---|---|
| PubChem CID | 123731155 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-tert-butyl-5-ethyl-2,6-dimethyl-7-[(Z)-prop-1-enyl]-4,5-dihydroazepin-3-imine |
| SMILES | C/C=C\C1=C(C)C(CC)C/C(=N\C(C)(C)C)C(C)=N1 |
| InChI | InChI=1S/C17H28N2/c1-8-10-15-12(3)14(9-2)11-16(13(4)18-15)19-17(5,6)7/h8,10,14H,9,11H2,1-7H3/b10-8-,19-16+ |
| InChIKey | ZJNPFBHVIMDHLZ-GHEIZMQMSA-N |
| XLogP | 4.97 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|