C20H31N — CID 91372726
N-(5-ethyl-5-methyl-2-prop-1-en-2-ylcyclohepta-1,3,6-trien-1-yl)heptan-2-imine (PubChem CID 91372726) has the molecular formula C20H31N and a molecular weight of 285.47 g/mol. Its IUPAC name is N-(5-ethyl-5-methyl-2-prop-1-en-2-ylcyclohepta-1,3,6-trien-1-yl)heptan-2-imine.
| Compound Name | N-(5-ethyl-5-methyl-2-prop-1-en-2-ylcyclohepta-1,3,6-trien-1-yl)heptan-2-imine |
|---|---|
| PubChem CID | 91372726 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | N-(5-ethyl-5-methyl-2-prop-1-en-2-ylcyclohepta-1,3,6-trien-1-yl)heptan-2-imine |
| SMILES | C=C(C)C1=C(/N=C(\C)CCCCC)C=CC(C)(CC)C=C1 |
| InChI | InChI=1S/C20H31N/c1-7-9-10-11-17(5)21-19-13-15-20(6,8-2)14-12-18(19)16(3)4/h12-15H,3,7-11H2,1-2,4-6H3/b21-17+ |
| InChIKey | AWASSSVZAAVAPI-HEHNFIMWSA-N |
| XLogP | 6.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|