C15H27N — CID 91055461
N-[(3Z)-hexa-1,3-dien-2-yl]-5,5-dimethylheptan-3-imine (PubChem CID 91055461) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is N-[(3Z)-hexa-1,3-dien-2-yl]-5,5-dimethylheptan-3-imine.
| Compound Name | N-[(3Z)-hexa-1,3-dien-2-yl]-5,5-dimethylheptan-3-imine |
|---|---|
| PubChem CID | 91055461 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | N-[(3Z)-hexa-1,3-dien-2-yl]-5,5-dimethylheptan-3-imine |
| SMILES | C=C(/C=C\CC)/N=C(\CC)CC(C)(C)CC |
| InChI | InChI=1S/C15H27N/c1-7-10-11-13(4)16-14(8-2)12-15(5,6)9-3/h10-11H,4,7-9,12H2,1-3,5-6H3/b11-10-,16-14+ |
| InChIKey | VEMMFFGTHBPLRC-XHINVYKMSA-N |
| XLogP | 5.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|