C20H29N — CID 91090148
(5Z)-2-but-2-en-2-yl-6-pent-2-en-2-yl-3-[(Z)-prop-1-enyl]-5-propylidene-4H-pyridine (PubChem CID 91090148) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is (5Z)-2-but-2-en-2-yl-6-pent-2-en-2-yl-3-[(Z)-prop-1-enyl]-5-propylidene-4H-pyridine.
| Compound Name | (5Z)-2-but-2-en-2-yl-6-pent-2-en-2-yl-3-[(Z)-prop-1-enyl]-5-propylidene-4H-pyridine |
|---|---|
| PubChem CID | 91090148 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | (5Z)-2-but-2-en-2-yl-6-pent-2-en-2-yl-3-[(Z)-prop-1-enyl]-5-propylidene-4H-pyridine |
| SMILES | CC=C(C)C1=C(/C=C\C)C/C(=C/CC)C(C(C)=CCC)=N1 |
| InChI | InChI=1S/C20H29N/c1-7-11-16(6)20-18(13-9-3)14-17(12-8-2)19(21-20)15(5)10-4/h8,10-13H,7,9,14H2,1-6H3/b12-8-,15-10?,16-11?,18-13- |
| InChIKey | QVCFAAWCCSXBCC-MVEUKDTDSA-N |
| XLogP | 6.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |