C22H29N — CID 91595142
3-[(1Z)-buta-1,3-dienyl]-4,6,10-trimethyl-5-prop-1-enyl-2-azabicyclo[6.5.0]trideca-1,3,8,12-tetraene (PubChem CID 91595142) has the molecular formula C22H29N and a molecular weight of 307.48 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-4,6,10-trimethyl-5-prop-1-enyl-2-azabicyclo[6.5.0]trideca-1,3,8,12-tetraene.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-4,6,10-trimethyl-5-prop-1-enyl-2-azabicyclo[6.5.0]trideca-1,3,8,12-tetraene |
|---|---|
| PubChem CID | 91595142 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-4,6,10-trimethyl-5-prop-1-enyl-2-azabicyclo[6.5.0]trideca-1,3,8,12-tetraene |
| SMILES | C=C/C=C\C1=C(C)C(C=CC)C(C)CC2=CC(C)CC=C/C2=N/1 |
| InChI | InChI=1S/C22H29N/c1-6-8-12-21-18(5)20(10-7-2)17(4)15-19-14-16(3)11-9-13-22(19)23-21/h6-10,12-14,16-17,20H,1,11,15H2,2-5H3/b10-7?,12-8-,21-18?,23-22- |
| InChIKey | GOEWSVSCEFMIQR-RDVXFGJZSA-N |
| XLogP | 6.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|