C17H25N3 — CID 138567401
7-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5,6-dimethyl-4-propan-2-yl-5H-1,3-diazepin-2-amine (PubChem CID 138567401) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 7-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5,6-dimethyl-4-propan-2-yl-5H-1,3-diazepin-2-amine.
| Compound Name | 7-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5,6-dimethyl-4-propan-2-yl-5H-1,3-diazepin-2-amine |
|---|---|
| PubChem CID | 138567401 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 7-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5,6-dimethyl-4-propan-2-yl-5H-1,3-diazepin-2-amine |
| SMILES | C=C/C=C(\C=C/C)C1=C(C)C(C)C(C(C)C)=NC(N)=N1 |
| InChI | InChI=1S/C17H25N3/c1-7-9-14(10-8-2)16-13(6)12(5)15(11(3)4)19-17(18)20-16/h7-12H,1H2,2-6H3,(H2,18,20)/b10-8-,14-9+ |
| InChIKey | SHDFCJYVWDJJEP-YYTLBARXSA-N |
| XLogP | 4.01 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|