C16H21N3 — CID 138567436
4,5,6-trimethyl-7-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-5H-1,3-diazepin-2-amine (PubChem CID 138567436) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 4,5,6-trimethyl-7-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-5H-1,3-diazepin-2-amine.
| Compound Name | 4,5,6-trimethyl-7-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-5H-1,3-diazepin-2-amine |
|---|---|
| PubChem CID | 138567436 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 4,5,6-trimethyl-7-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-5H-1,3-diazepin-2-amine |
| SMILES | C=C/C=C\C(=C/C=C)C1=C(C)C(C)C(C)=NC(N)=N1 |
| InChI | InChI=1S/C16H21N3/c1-6-8-10-14(9-7-2)15-12(4)11(3)13(5)18-16(17)19-15/h6-11H,1-2H2,3-5H3,(H2,17,19)/b10-8-,14-9+ |
| InChIKey | GWAGYUOXAXJQIM-YYTLBARXSA-N |
| XLogP | 3.54 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|