C17H26N2 — CID 176531459
(2Z,4Z)-4-ethylidene-6-methyl-N'-(3-methylbut-2-en-2-yl)nona-2,7,8-trienimidamide (PubChem CID 176531459) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is (2Z,4Z)-4-ethylidene-6-methyl-N'-(3-methylbut-2-en-2-yl)nona-2,7,8-trienimidamide.
| Compound Name | (2Z,4Z)-4-ethylidene-6-methyl-N'-(3-methylbut-2-en-2-yl)nona-2,7,8-trienimidamide |
|---|---|
| PubChem CID | 176531459 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | (2Z,4Z)-4-ethylidene-6-methyl-N'-(3-methylbut-2-en-2-yl)nona-2,7,8-trienimidamide |
| SMILES | C=C=CC(C)CC(/C=C\C(N)=N\C(C)=C(C)C)=C/C |
| InChI | InChI=1S/C17H26N2/c1-7-9-14(5)12-16(8-2)10-11-17(18)19-15(6)13(3)4/h8-11,14H,1,12H2,2-6H3,(H2,18,19)/b11-10-,16-8+ |
| InChIKey | YNFVOZKQTGDJKA-TZINGHKZSA-N |
| XLogP | 4.53 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|