C22H36N2 — CID 138567426
2-methyl-N'-[(3E,5Z)-6,7,9-trimethyl-8-methylidene-4-[(Z)-prop-1-enyl]deca-1,3,5-trien-5-yl]butanimidamide (PubChem CID 138567426) has the molecular formula C22H36N2 and a molecular weight of 328.54 g/mol. Its IUPAC name is 2-methyl-N'-[(3E,5Z)-6,7,9-trimethyl-8-methylidene-4-[(Z)-prop-1-enyl]deca-1,3,5-trien-5-yl]butanimidamide.
| Compound Name | 2-methyl-N'-[(3E,5Z)-6,7,9-trimethyl-8-methylidene-4-[(Z)-prop-1-enyl]deca-1,3,5-trien-5-yl]butanimidamide |
|---|---|
| PubChem CID | 138567426 |
| Molecular Formula | C22H36N2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.29 |
| IUPAC Name | 2-methyl-N'-[(3E,5Z)-6,7,9-trimethyl-8-methylidene-4-[(Z)-prop-1-enyl]deca-1,3,5-trien-5-yl]butanimidamide |
| SMILES | C=C/C=C(\C=C/C)C(/N=C(\N)C(C)CC)=C(\C)C(C)C(=C)C(C)C |
| InChI | InChI=1S/C22H36N2/c1-10-13-20(14-11-2)21(24-22(23)16(6)12-3)19(9)18(8)17(7)15(4)5/h10-11,13-16,18H,1,7,12H2,2-6,8-9H3,(H2,23,24)/b14-11-,20-13+,21-19- |
| InChIKey | FDYYGHLDKMPQRR-UTNHUYOESA-N |
| XLogP | 6.20 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|