C19H29N — CID 129215166
(Z,5E)-5-ethylidene-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-8-methylnon-2-en-4-imine (PubChem CID 129215166) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is (Z,5E)-5-ethylidene-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-8-methylnon-2-en-4-imine.
| Compound Name | (Z,5E)-5-ethylidene-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-8-methylnon-2-en-4-imine |
|---|---|
| PubChem CID | 129215166 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | (Z,5E)-5-ethylidene-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-8-methylnon-2-en-4-imine |
| SMILES | C=C/C=C\C=C(C)\N=C(\C=C/C)C(=C/C)/CCC(C)C |
| InChI | InChI=1S/C19H29N/c1-7-10-11-13-17(6)20-19(12-8-2)18(9-3)15-14-16(4)5/h7-13,16H,1,14-15H2,2-6H3/b11-10-,12-8-,17-13+,18-9+,20-19- |
| InChIKey | FQOAEUNANUTVMQ-IAJHTLINSA-N |
| XLogP | 6.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|