C22H35N — CID 123400833
N-(1-cyclopentylidenehexa-2,3-dienyl)-4-(3-methylbutyl)cyclohexan-1-imine (PubChem CID 123400833) has the molecular formula C22H35N and a molecular weight of 313.53 g/mol. Its IUPAC name is N-(1-cyclopentylidenehexa-2,3-dienyl)-4-(3-methylbutyl)cyclohexan-1-imine.
| Compound Name | N-(1-cyclopentylidenehexa-2,3-dienyl)-4-(3-methylbutyl)cyclohexan-1-imine |
|---|---|
| PubChem CID | 123400833 |
| Molecular Formula | C22H35N |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | N-(1-cyclopentylidenehexa-2,3-dienyl)-4-(3-methylbutyl)cyclohexan-1-imine |
| SMILES | CCC=C=CC(N=C1CCC(CCC(C)C)CC1)=C1CCCC1 |
| InChI | InChI=1S/C22H35N/c1-4-5-6-11-22(20-9-7-8-10-20)23-21-16-14-19(15-17-21)13-12-18(2)3/h5,11,18-19H,4,7-10,12-17H2,1-3H3/b23-21- |
| InChIKey | VWSFZCRVYMQIAH-LNVKXUELSA-N |
| XLogP | 7.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|