C17H27N — CID 167102497
1-(4-ethenylcyclohexyl)-N-[(2Z,4E)-4-methylhexa-2,4-dien-2-yl]ethanimine (PubChem CID 167102497) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 1-(4-ethenylcyclohexyl)-N-[(2Z,4E)-4-methylhexa-2,4-dien-2-yl]ethanimine.
| Compound Name | 1-(4-ethenylcyclohexyl)-N-[(2Z,4E)-4-methylhexa-2,4-dien-2-yl]ethanimine |
|---|---|
| PubChem CID | 167102497 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 1-(4-ethenylcyclohexyl)-N-[(2Z,4E)-4-methylhexa-2,4-dien-2-yl]ethanimine |
| SMILES | C=CC1CCC(/C(C)=N/C(C)=C\C(C)=C\C)CC1 |
| InChI | InChI=1S/C17H27N/c1-6-13(3)12-14(4)18-15(5)17-10-8-16(7-2)9-11-17/h6-7,12,16-17H,2,8-11H2,1,3-5H3/b13-6+,14-12-,18-15+ |
| InChIKey | MRBYQVOKPFMTNY-IKWQPIKQSA-N |
| XLogP | 5.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|