C8H17NO — CID 162270276
3-methyl-2-propyl-1,3-oxazinane (PubChem CID 162270276) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is 3-methyl-2-propyl-1,3-oxazinane.
| Compound Name | 3-methyl-2-propyl-1,3-oxazinane |
|---|---|
| PubChem CID | 162270276 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 3-methyl-2-propyl-1,3-oxazinane |
| SMILES | CCCC1OCCCN1C |
| InChI | InChI=1S/C8H17NO/c1-3-5-8-9(2)6-4-7-10-8/h8H,3-7H2,1-2H3 |
| InChIKey | BYDKDFWAIKGALJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |