C40H64 — CID 162278750
12-(cyclopentylmethyl)-5,5,8,8,16,16,19,19-octamethylpentacyclo[11.8.0.02,11.04,9.015,20]henicosa-3,9,14,20-tetraene;2,2-dimethylpropane (PubChem CID 162278750) has the molecular formula C40H64 and a molecular weight of 544.95 g/mol. Its IUPAC name is 12-(cyclopentylmethyl)-5,5,8,8,16,16,19,19-octamethylpentacyclo[11.8.0.02,11.04,9.015,20]henicosa-3,9,14,20-tetraene;2,2-dimethylpropane.
| Compound Name | 12-(cyclopentylmethyl)-5,5,8,8,16,16,19,19-octamethylpentacyclo[11.8.0.02,11.04,9.015,20]henicosa-3,9,14,20-tetraene;2,2-dimethylpropane |
|---|---|
| PubChem CID | 162278750 |
| Molecular Formula | C40H64 |
| Molecular Weight | 544.95 g/mol |
| Exact Mass | 544.50 |
| IUPAC Name | 12-(cyclopentylmethyl)-5,5,8,8,16,16,19,19-octamethylpentacyclo[11.8.0.02,11.04,9.015,20]henicosa-3,9,14,20-tetraene;2,2-dimethylpropane |
| SMILES | CC(C)(C)C.CC1(C)CCC(C)(C)C2=CC3C(C=C21)C1C=C2C(=CC1C3CC1CCCC1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C35H52.C5H12/c1-32(2)13-15-34(5,6)30-20-26-24(18-28(30)32)23(17-22-11-9-10-12-22)25-19-29-31(21-27(25)26)35(7,8)16-14-33(29,3)4;1-5(2,3)4/h18-27H,9-17H2,1-8H3;1-4H3 |
| InChIKey | LYHCYPJJMFXBID-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.95 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |