C12H27N2+ — CID 162280734
1,1,5,5-tetramethyl-3-(3-methylbutan-2-yl)imidazolidin-1-ium (PubChem CID 162280734) has the molecular formula C12H27N2+ and a molecular weight of 199.36 g/mol. Its IUPAC name is 1,1,5,5-tetramethyl-3-(3-methylbutan-2-yl)imidazolidin-1-ium.
| Compound Name | 1,1,5,5-tetramethyl-3-(3-methylbutan-2-yl)imidazolidin-1-ium |
|---|---|
| PubChem CID | 162280734 |
| Molecular Formula | C12H27N2+ |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.22 |
| IUPAC Name | 1,1,5,5-tetramethyl-3-(3-methylbutan-2-yl)imidazolidin-1-ium |
| SMILES | CC(C)C(C)N1CC(C)(C)[N+](C)(C)C1 |
| InChI | InChI=1S/C12H27N2/c1-10(2)11(3)13-8-12(4,5)14(6,7)9-13/h10-11H,8-9H2,1-7H3/q+1 |
| InChIKey | FDZKUSMJXOINPG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|