C49H72N2OSi3 — CID 162286493
bis[5-(dimethylsilylmethyl)-8-methyl-4b,9b,10,10a-tetrahydro-4aH-indeno[1,2-b]indol-10-yl]-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane (PubChem CID 162286493) has the molecular formula C49H72N2OSi3 and a molecular weight of 789.39 g/mol. Its IUPAC name is bis[5-(dimethylsilylmethyl)-8-methyl-4b,9b,10,10a-tetrahydro-4aH-indeno[1,2-b]indol-10-yl]-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane.
| Compound Name | bis[5-(dimethylsilylmethyl)-8-methyl-4b,9b,10,10a-tetrahydro-4aH-indeno[1,2-b]indol-10-yl]-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
|---|---|
| PubChem CID | 162286493 |
| Molecular Formula | C49H72N2OSi3 |
| Molecular Weight | 789.39 g/mol |
| Exact Mass | 788.50 |
| IUPAC Name | bis[5-(dimethylsilylmethyl)-8-methyl-4b,9b,10,10a-tetrahydro-4aH-indeno[1,2-b]indol-10-yl]-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
| SMILES | Cc1ccc2c(c1)C1C(C3C=CC=CC3C1[Si](C)(CCCCCCOC(C)(C)C)C1C3C=CC=CC3C3C1c1cc(C)ccc1N3C[SiH](C)C)N2C[SiH](C)C |
| InChI | InChI=1S/C49H72N2OSi3/c1-33-23-25-41-39(29-33)43-45(50(41)31-53(6)7)35-19-13-15-21-37(35)47(43)55(10,28-18-12-11-17-27-52-49(3,4)5)48-38-22-16-14-20-36(38)46-44(48)40-30-34(2)24-26-42(40)51(46)32-54(8)9/h13-16,19-26,29-30,35-38,43-48,53-54H,11-12,17-18,27-28,31-32H2,1-10H3 |
| InChIKey | TVHTZHVESVVKLY-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.39 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|