C37H54Cl2NOSiTi- — CID 172523454
2-tert-butyl-6-[diethyl-(8-methyl-5-pentyl-4b,9b,10,10a-tetrahydro-4aH-indeno[1,2-b]indol-10-yl)silyl]-4-methylphenol;carbanide;dichlorotitanium (PubChem CID 172523454) has the molecular formula C37H54Cl2NOSiTi- and a molecular weight of 675.70 g/mol. Its IUPAC name is 2-tert-butyl-6-[diethyl-(8-methyl-5-pentyl-4b,9b,10,10a-tetrahydro-4aH-indeno[1,2-b]indol-10-yl)silyl]-4-methylphenol;carbanide;dichlorotitanium.
| Compound Name | 2-tert-butyl-6-[diethyl-(8-methyl-5-pentyl-4b,9b,10,10a-tetrahydro-4aH-indeno[1,2-b]indol-10-yl)silyl]-4-methylphenol;carbanide;dichlorotitanium |
|---|---|
| PubChem CID | 172523454 |
| Molecular Formula | C37H54Cl2NOSiTi- |
| Molecular Weight | 675.70 g/mol |
| Exact Mass | 674.28 |
| IUPAC Name | 2-tert-butyl-6-[diethyl-(8-methyl-5-pentyl-4b,9b,10,10a-tetrahydro-4aH-indeno[1,2-b]indol-10-yl)silyl]-4-methylphenol;carbanide;dichlorotitanium |
| SMILES | CCCCCN1c2ccc(C)cc2C2C1C1C=CC=CC1C2[Si](CC)(CC)c1cc(C)cc(C(C)(C)C)c1O.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C36H51NOSi.CH3.2ClH.Ti/c1-9-12-15-20-37-30-19-18-24(4)21-28(30)32-33(37)26-16-13-14-17-27(26)35(32)39(10-2,11-3)31-23-25(5)22-29(34(31)38)36(6,7)8;;;;/h13-14,16-19,21-23,26-27,32-33,35,38H,9-12,15,20H2,1-8H3;1H3;2*1H;/q;-1;;;+2/p-2 |
| InChIKey | LGPJLFFIBLWARH-UHFFFAOYSA-L |
| XLogP | 10.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.70 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|