C27H41Cl2OS2SiTi- — CID 162303901
2-tert-butyl-6-[(4,10-dimethyl-5,9-dithiatricyclo[6.3.0.02,6]undeca-3,10-dien-7-yl)-diethylsilyl]-4-methylphenol;carbanide;dichlorotitanium (PubChem CID 162303901) has the molecular formula C27H41Cl2OS2SiTi- and a molecular weight of 592.62 g/mol. Its IUPAC name is 2-tert-butyl-6-[(4,10-dimethyl-5,9-dithiatricyclo[6.3.0.02,6]undeca-3,10-dien-7-yl)-diethylsilyl]-4-methylphenol;carbanide;dichlorotitanium.
| Compound Name | 2-tert-butyl-6-[(4,10-dimethyl-5,9-dithiatricyclo[6.3.0.02,6]undeca-3,10-dien-7-yl)-diethylsilyl]-4-methylphenol;carbanide;dichlorotitanium |
|---|---|
| PubChem CID | 162303901 |
| Molecular Formula | C27H41Cl2OS2SiTi- |
| Molecular Weight | 592.62 g/mol |
| Exact Mass | 591.12 |
| IUPAC Name | 2-tert-butyl-6-[(4,10-dimethyl-5,9-dithiatricyclo[6.3.0.02,6]undeca-3,10-dien-7-yl)-diethylsilyl]-4-methylphenol;carbanide;dichlorotitanium |
| SMILES | CC[Si](CC)(c1cc(C)cc(C(C)(C)C)c1O)C1C2SC(C)=CC2C2C=C(C)SC21.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C26H38OS2Si.CH3.2ClH.Ti/c1-9-30(10-2,21-12-15(3)11-20(22(21)27)26(6,7)8)25-23-18(13-16(4)28-23)19-14-17(5)29-24(19)25;;;;/h11-14,18-19,23-25,27H,9-10H2,1-8H3;1H3;2*1H;/q;-1;;;+2/p-2 |
| InChIKey | JPFGVEAUWPEDPJ-UHFFFAOYSA-L |
| XLogP | 9.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.62 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|