C22H33Cl2OSiTi — CID 10950592
CID 10950592 (PubChem CID 10950592) has the molecular formula C22H33Cl2OSiTi and a molecular weight of 460.36 g/mol.
| Compound Name | CID 10950592 |
|---|---|
| PubChem CID | 10950592 |
| Molecular Formula | C22H33Cl2OSiTi |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | — |
| SMILES | C[C]1[C](C)[C](C)[C]([Si](C)(C)c2cc(C)cc(C(C)(C)C)c2O)[C]1C.Cl[Ti]Cl |
| InChI | InChI=1S/C22H33OSi.2ClH.Ti/c1-13-11-18(22(6,7)8)20(23)19(12-13)24(9,10)21-16(4)14(2)15(3)17(21)5;;;/h11-12,23H,1-10H3;2*1H;/q;;;+2/p-2 |
| InChIKey | VFPPTUXZAARADB-UHFFFAOYSA-L |
| XLogP | 6.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|