C31H45Cl2OSiTi- — CID 156679945
2-tert-butyl-6-[[(2R)-1,2-dimethyl-2,3,3a,9b-tetrahydro-1H-cyclopenta[a]naphthalen-3-yl]-diethylsilyl]-4-methylphenol;carbanide;dichlorotitanium (PubChem CID 156679945) has the molecular formula C31H45Cl2OSiTi- and a molecular weight of 580.56 g/mol. Its IUPAC name is 2-tert-butyl-6-[[(2R)-1,2-dimethyl-2,3,3a,9b-tetrahydro-1H-cyclopenta[a]naphthalen-3-yl]-diethylsilyl]-4-methylphenol;carbanide;dichlorotitanium.
| Compound Name | 2-tert-butyl-6-[[(2R)-1,2-dimethyl-2,3,3a,9b-tetrahydro-1H-cyclopenta[a]naphthalen-3-yl]-diethylsilyl]-4-methylphenol;carbanide;dichlorotitanium |
|---|---|
| PubChem CID | 156679945 |
| Molecular Formula | C31H45Cl2OSiTi- |
| Molecular Weight | 580.56 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | 2-tert-butyl-6-[[(2R)-1,2-dimethyl-2,3,3a,9b-tetrahydro-1H-cyclopenta[a]naphthalen-3-yl]-diethylsilyl]-4-methylphenol;carbanide;dichlorotitanium |
| SMILES | CC[Si](CC)(c1cc(C)cc(C(C)(C)C)c1O)C1C2C=Cc3ccccc3C2C(C)[C@H]1C.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C30H42OSi.CH3.2ClH.Ti/c1-9-32(10-2,26-18-19(3)17-25(28(26)31)30(6,7)8)29-21(5)20(4)27-23-14-12-11-13-22(23)15-16-24(27)29;;;;/h11-18,20-21,24,27,29,31H,9-10H2,1-8H3;1H3;2*1H;/q;-1;;;+2/p-2/t20?,21-,24?,27?,29?;;;;/m1..../s1 |
| InChIKey | HVGBRTNFJLVBQT-TYHYLFHTSA-L |
| XLogP | 9.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.56 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|