C13H29N2+ — CID 162288863
(1R)-1-ethyl-1,5,5-trimethyl-3-(2-methylbutan-2-yl)imidazolidin-1-ium (PubChem CID 162288863) has the molecular formula C13H29N2+ and a molecular weight of 213.39 g/mol. Its IUPAC name is (1R)-1-ethyl-1,5,5-trimethyl-3-(2-methylbutan-2-yl)imidazolidin-1-ium.
| Compound Name | (1R)-1-ethyl-1,5,5-trimethyl-3-(2-methylbutan-2-yl)imidazolidin-1-ium |
|---|---|
| PubChem CID | 162288863 |
| Molecular Formula | C13H29N2+ |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.23 |
| IUPAC Name | (1R)-1-ethyl-1,5,5-trimethyl-3-(2-methylbutan-2-yl)imidazolidin-1-ium |
| SMILES | CCC(C)(C)N1CC(C)(C)[N@@+](C)(CC)C1 |
| InChI | InChI=1S/C13H29N2/c1-8-12(3,4)14-10-13(5,6)15(7,9-2)11-14/h8-11H2,1-7H3/q+1/t15-/m0/s1 |
| InChIKey | VZFJRAAVSVKYNG-HNNXBMFYSA-N |
| XLogP | 2.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|