About carbanide;(3-ethyl-4-oxopent-1-enyl)-triphenylphosphanium
carbanide;(3-ethyl-4-oxopent-1-enyl)-triphenylphosphanium (PubChem CID 162289350) has the molecular formula C26H29OP
and a molecular weight of 388.49 g/mol. Its IUPAC name is carbanide;(3-ethyl-4-oxopent-1-enyl)-triphenylphosphanium.
Molecular Properties
| Compound Name | carbanide;(3-ethyl-4-oxopent-1-enyl)-triphenylphosphanium |
| PubChem CID | 162289350 |
| Molecular Formula | C26H29OP |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | carbanide;(3-ethyl-4-oxopent-1-enyl)-triphenylphosphanium |
| SMILES | CCC(C=C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(C)=O.[CH3-] |
| InChI | InChI=1S/C25H26OP.CH3/c1-3-22(21(2)26)19-20-27(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25;/h4-20,22H,3H2,1-2H3;1H3/q+1;-1 |
| InChIKey | HXXIWQSPOXUWID-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbanide;(3-ethyl-4-oxopent-1-enyl)-triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;(3-ethyl-4-oxopent-1-enyl)-triphenylphosphanium?
The IUPAC name of carbanide;(3-ethyl-4-oxopent-1-enyl)-triphenylphosphanium (CID 162289350) is carbanide;(3-ethyl-4-oxopent-1-enyl)-triphenylphosphanium.
What is the SMILES notation for carbanide;(3-ethyl-4-oxopent-1-enyl)-triphenylphosphanium?
The canonical SMILES for carbanide;(3-ethyl-4-oxopent-1-enyl)-triphenylphosphanium is CCC(C=C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(C)=O.[CH3-].
What is the InChIKey of carbanide;(3-ethyl-4-oxopent-1-enyl)-triphenylphosphanium?
The InChIKey is HXXIWQSPOXUWID-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26OP.CH3/c1-3-22(21(2)26)19-20-27(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25;/h4-20,22H,3H2,1-2H3;1H3/q+1;-1.
What are the key properties of carbanide;(3-ethyl-4-oxopent-1-enyl)-triphenylphosphanium?
carbanide;(3-ethyl-4-oxopent-1-enyl)-triphenylphosphanium has a molecular weight of 388.49 g/mol, XLogP of 5.56, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;(3-ethyl-4-oxopent-1-enyl)-triphenylphosphanium is sourced from PubChem (CID 162289350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).