C41H69N2Si+ — CID 162290206
[tert-butyl-[(11,11-dibutyl-15,15,18,18-tetramethyl-7-pentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(20),2,9,12,14(19)-pentaenyl)-dimethylsilyl]amino]-trimethylazanium (PubChem CID 162290206) has the molecular formula C41H69N2Si+ and a molecular weight of 618.10 g/mol. Its IUPAC name is [tert-butyl-[(11,11-dibutyl-15,15,18,18-tetramethyl-7-pentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(20),2,9,12,14(19)-pentaenyl)-dimethylsilyl]amino]-trimethylazanium.
| Compound Name | [tert-butyl-[(11,11-dibutyl-15,15,18,18-tetramethyl-7-pentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(20),2,9,12,14(19)-pentaenyl)-dimethylsilyl]amino]-trimethylazanium |
|---|---|
| PubChem CID | 162290206 |
| Molecular Formula | C41H69N2Si+ |
| Molecular Weight | 618.10 g/mol |
| Exact Mass | 617.52 |
| IUPAC Name | [tert-butyl-[(11,11-dibutyl-15,15,18,18-tetramethyl-7-pentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(20),2,9,12,14(19)-pentaenyl)-dimethylsilyl]amino]-trimethylazanium |
| SMILES | CCCCC1(CCCC)C2=CC3C(C=C2c2cc4c(cc21)C(C)(C)CCC4(C)C)CCC3[Si](C)(C)N(C(C)(C)C)[N+](C)(C)C |
| InChI | InChI=1S/C41H69N2Si/c1-15-17-21-41(22-18-16-2)33-26-30-29(19-20-37(30)44(13,14)42(38(3,4)5)43(10,11)12)25-31(33)32-27-35-36(28-34(32)41)40(8,9)24-23-39(35,6)7/h25-30,37H,15-24H2,1-14H3/q+1 |
| InChIKey | HJXLRJVRNNPOHT-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.10 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|