C39H52N3Si+ — CID 162284572
[tert-butyl-[[9,9-dimethyl-7-(N-phenylanilino)-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-1-yl]-dimethylsilyl]amino]-trimethylazanium (PubChem CID 162284572) has the molecular formula C39H52N3Si+ and a molecular weight of 590.95 g/mol. Its IUPAC name is [tert-butyl-[[9,9-dimethyl-7-(N-phenylanilino)-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-1-yl]-dimethylsilyl]amino]-trimethylazanium.
| Compound Name | [tert-butyl-[[9,9-dimethyl-7-(N-phenylanilino)-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-1-yl]-dimethylsilyl]amino]-trimethylazanium |
|---|---|
| PubChem CID | 162284572 |
| Molecular Formula | C39H52N3Si+ |
| Molecular Weight | 590.95 g/mol |
| Exact Mass | 590.39 |
| IUPAC Name | [tert-butyl-[[9,9-dimethyl-7-(N-phenylanilino)-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-1-yl]-dimethylsilyl]amino]-trimethylazanium |
| SMILES | CC1(C)C2=CC3C(C=C2c2ccc(N(c4ccccc4)c4ccccc4)cc21)CCC3[Si](C)(C)N(C(C)(C)C)[N+](C)(C)C |
| InChI | InChI=1S/C39H52N3Si/c1-38(2,3)41(42(6,7)8)43(9,10)37-24-21-28-25-34-32-23-22-31(26-35(32)39(4,5)36(34)27-33(28)37)40(29-17-13-11-14-18-29)30-19-15-12-16-20-30/h11-20,22-23,25-28,33,37H,21,24H2,1-10H3/q+1 |
| InChIKey | LCZMWXXTAVXISC-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.95 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|