C40H52N2Si — CID 162284566
1-[(ditert-butylamino)-dimethylsilyl]-9,9-dimethyl-N,N-diphenyl-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-7-amine (PubChem CID 162284566) has the molecular formula C40H52N2Si and a molecular weight of 588.96 g/mol. Its IUPAC name is 1-[(ditert-butylamino)-dimethylsilyl]-9,9-dimethyl-N,N-diphenyl-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-7-amine.
| Compound Name | 1-[(ditert-butylamino)-dimethylsilyl]-9,9-dimethyl-N,N-diphenyl-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-7-amine |
|---|---|
| PubChem CID | 162284566 |
| Molecular Formula | C40H52N2Si |
| Molecular Weight | 588.96 g/mol |
| Exact Mass | 588.39 |
| IUPAC Name | 1-[(ditert-butylamino)-dimethylsilyl]-9,9-dimethyl-N,N-diphenyl-2,3,3a,10a-tetrahydro-1H-cyclopenta[b]fluoren-7-amine |
| SMILES | CC1(C)C2=CC3C(C=C2c2ccc(N(c4ccccc4)c4ccccc4)cc21)CCC3[Si](C)(C)N(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C40H52N2Si/c1-38(2,3)42(39(4,5)6)43(9,10)37-24-21-28-25-34-32-23-22-31(26-35(32)40(7,8)36(34)27-33(28)37)41(29-17-13-11-14-18-29)30-19-15-12-16-20-30/h11-20,22-23,25-28,33,37H,21,24H2,1-10H3 |
| InChIKey | ZTPIVMAESXYJBS-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.96 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|